C10H14BrNO2 — CID 21117288
4-bromo-N-ethyl-2,5-dimethoxyaniline (PubChem CID 21117288) has the molecular formula C10H14BrNO2 and a molecular weight of 260.13 g/mol. Its IUPAC name is 4-bromo-N-ethyl-2,5-dimethoxyaniline.
| Compound Name | 4-bromo-N-ethyl-2,5-dimethoxyaniline |
|---|---|
| PubChem CID | 21117288 |
| Molecular Formula | C10H14BrNO2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 4-bromo-N-ethyl-2,5-dimethoxyaniline |
| SMILES | CCNc1cc(OC)c(Br)cc1OC |
| InChI | InChI=1S/C10H14BrNO2/c1-4-12-8-6-9(13-2)7(11)5-10(8)14-3/h5-6,12H,4H2,1-3H3 |
| InChIKey | DOEIGPBWDHKZMR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |