C13H17Br2NO — CID 103412121
2,4-dibromo-N-(cyclopentylmethyl)-5-methoxyaniline (PubChem CID 103412121) has the molecular formula C13H17Br2NO and a molecular weight of 363.09 g/mol. Its IUPAC name is 2,4-dibromo-N-(cyclopentylmethyl)-5-methoxyaniline.
| Compound Name | 2,4-dibromo-N-(cyclopentylmethyl)-5-methoxyaniline |
|---|---|
| PubChem CID | 103412121 |
| Molecular Formula | C13H17Br2NO |
| Molecular Weight | 363.09 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | 2,4-dibromo-N-(cyclopentylmethyl)-5-methoxyaniline |
| SMILES | COc1cc(NCC2CCCC2)c(Br)cc1Br |
| InChI | InChI=1S/C13H17Br2NO/c1-17-13-7-12(10(14)6-11(13)15)16-8-9-4-2-3-5-9/h6-7,9,16H,2-5,8H2,1H3 |
| InChIKey | NBBFYFFRSLSHRC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.09 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |