C14H16Br2F3NO — CID 103412212
2,4-dibromo-5-methoxy-N-[2-(trifluoromethyl)cyclohexyl]aniline (PubChem CID 103412212) has the molecular formula C14H16Br2F3NO and a molecular weight of 431.09 g/mol. Its IUPAC name is 2,4-dibromo-5-methoxy-N-[2-(trifluoromethyl)cyclohexyl]aniline.
| Compound Name | 2,4-dibromo-5-methoxy-N-[2-(trifluoromethyl)cyclohexyl]aniline |
|---|---|
| PubChem CID | 103412212 |
| Molecular Formula | C14H16Br2F3NO |
| Molecular Weight | 431.09 g/mol |
| Exact Mass | 428.96 |
| IUPAC Name | 2,4-dibromo-5-methoxy-N-[2-(trifluoromethyl)cyclohexyl]aniline |
| SMILES | COc1cc(NC2CCCCC2C(F)(F)F)c(Br)cc1Br |
| InChI | InChI=1S/C14H16Br2F3NO/c1-21-13-7-12(9(15)6-10(13)16)20-11-5-3-2-4-8(11)14(17,18)19/h6-8,11,20H,2-5H2,1H3 |
| InChIKey | QHZUXFFIPOLDIV-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.09 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |