C11H13Br2NO4S — CID 103413334
4-(2,4-dibromo-5-methoxyanilino)-1,1-dioxothiolan-3-ol (PubChem CID 103413334) has the molecular formula C11H13Br2NO4S and a molecular weight of 415.10 g/mol. Its IUPAC name is 4-(2,4-dibromo-5-methoxyanilino)-1,1-dioxothiolan-3-ol.
| Compound Name | 4-(2,4-dibromo-5-methoxyanilino)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 103413334 |
| Molecular Formula | C11H13Br2NO4S |
| Molecular Weight | 415.10 g/mol |
| Exact Mass | 412.89 |
| IUPAC Name | 4-(2,4-dibromo-5-methoxyanilino)-1,1-dioxothiolan-3-ol |
| SMILES | COc1cc(NC2CS(=O)(=O)CC2O)c(Br)cc1Br |
| InChI | InChI=1S/C11H13Br2NO4S/c1-18-11-3-8(6(12)2-7(11)13)14-9-4-19(16,17)5-10(9)15/h2-3,9-10,14-15H,4-5H2,1H3 |
| InChIKey | LPRANRFCIRDYRS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.10 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |