C14H19Br2NO2 — CID 103412767
2-(2,4-dibromo-5-methoxyanilino)cycloheptan-1-ol (PubChem CID 103412767) has the molecular formula C14H19Br2NO2 and a molecular weight of 393.12 g/mol. Its IUPAC name is 2-(2,4-dibromo-5-methoxyanilino)cycloheptan-1-ol.
| Compound Name | 2-(2,4-dibromo-5-methoxyanilino)cycloheptan-1-ol |
|---|---|
| PubChem CID | 103412767 |
| Molecular Formula | C14H19Br2NO2 |
| Molecular Weight | 393.12 g/mol |
| Exact Mass | 390.98 |
| IUPAC Name | 2-(2,4-dibromo-5-methoxyanilino)cycloheptan-1-ol |
| SMILES | COc1cc(NC2CCCCCC2O)c(Br)cc1Br |
| InChI | InChI=1S/C14H19Br2NO2/c1-19-14-8-12(9(15)7-10(14)16)17-11-5-3-2-4-6-13(11)18/h7-8,11,13,17-18H,2-6H2,1H3 |
| InChIKey | RWCOQMGLINQIQR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.12 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |