C15H19BrF3N — CID 107572276
4-bromo-3,5-dimethyl-N-[2-(trifluoromethyl)cyclohexyl]aniline (PubChem CID 107572276) has the molecular formula C15H19BrF3N and a molecular weight of 350.22 g/mol. Its IUPAC name is 4-bromo-3,5-dimethyl-N-[2-(trifluoromethyl)cyclohexyl]aniline.
| Compound Name | 4-bromo-3,5-dimethyl-N-[2-(trifluoromethyl)cyclohexyl]aniline |
|---|---|
| PubChem CID | 107572276 |
| Molecular Formula | C15H19BrF3N |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 4-bromo-3,5-dimethyl-N-[2-(trifluoromethyl)cyclohexyl]aniline |
| SMILES | Cc1cc(NC2CCCCC2C(F)(F)F)cc(C)c1Br |
| InChI | InChI=1S/C15H19BrF3N/c1-9-7-11(8-10(2)14(9)16)20-13-6-4-3-5-12(13)15(17,18)19/h7-8,12-13,20H,3-6H2,1-2H3 |
| InChIKey | GTMWPRYFSJDBNH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |