C14H17ClF3N — CID 64758056
4-chloro-2-methyl-N-[2-(trifluoromethyl)cyclohexyl]aniline (PubChem CID 64758056) has the molecular formula C14H17ClF3N and a molecular weight of 291.74 g/mol. Its IUPAC name is 4-chloro-2-methyl-N-[2-(trifluoromethyl)cyclohexyl]aniline.
| Compound Name | 4-chloro-2-methyl-N-[2-(trifluoromethyl)cyclohexyl]aniline |
|---|---|
| PubChem CID | 64758056 |
| Molecular Formula | C14H17ClF3N |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 4-chloro-2-methyl-N-[2-(trifluoromethyl)cyclohexyl]aniline |
| SMILES | Cc1cc(Cl)ccc1NC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C14H17ClF3N/c1-9-8-10(15)6-7-12(9)19-13-5-3-2-4-11(13)14(16,17)18/h6-8,11,13,19H,2-5H2,1H3 |
| InChIKey | UVYWPGLKINTYMN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |