C11H15ClN2 — CID 80558984
1-N-(4-chloro-2-methylphenyl)cyclobutane-1,3-diamine (PubChem CID 80558984) has the molecular formula C11H15ClN2 and a molecular weight of 210.71 g/mol. Its IUPAC name is 1-N-(4-chloro-2-methylphenyl)cyclobutane-1,3-diamine.
| Compound Name | 1-N-(4-chloro-2-methylphenyl)cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 80558984 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 1-N-(4-chloro-2-methylphenyl)cyclobutane-1,3-diamine |
| SMILES | Cc1cc(Cl)ccc1NC1CC(N)C1 |
| InChI | InChI=1S/C11H15ClN2/c1-7-4-8(12)2-3-11(7)14-10-5-9(13)6-10/h2-4,9-10,14H,5-6,13H2,1H3 |
| InChIKey | ZBHSBYIJXNTBSB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |