C16H23Cl2N — CID 55199009
N-(2-tert-butylcyclohexyl)-2,4-dichloroaniline (PubChem CID 55199009) has the molecular formula C16H23Cl2N and a molecular weight of 300.27 g/mol. Its IUPAC name is N-(2-tert-butylcyclohexyl)-2,4-dichloroaniline.
| Compound Name | N-(2-tert-butylcyclohexyl)-2,4-dichloroaniline |
|---|---|
| PubChem CID | 55199009 |
| Molecular Formula | C16H23Cl2N |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N-(2-tert-butylcyclohexyl)-2,4-dichloroaniline |
| SMILES | CC(C)(C)C1CCCCC1Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H23Cl2N/c1-16(2,3)12-6-4-5-7-14(12)19-15-9-8-11(17)10-13(15)18/h8-10,12,14,19H,4-7H2,1-3H3 |
| InChIKey | COBGEOCJALGGFK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |