C13H14Cl2N2 — CID 62742203
2-(2,4-dichloroanilino)cyclohexane-1-carbonitrile (PubChem CID 62742203) has the molecular formula C13H14Cl2N2 and a molecular weight of 269.17 g/mol. Its IUPAC name is 2-(2,4-dichloroanilino)cyclohexane-1-carbonitrile.
| Compound Name | 2-(2,4-dichloroanilino)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 62742203 |
| Molecular Formula | C13H14Cl2N2 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-(2,4-dichloroanilino)cyclohexane-1-carbonitrile |
| SMILES | N#CC1CCCCC1Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl2N2/c14-10-5-6-13(11(15)7-10)17-12-4-2-1-3-9(12)8-16/h5-7,9,12,17H,1-4H2 |
| InChIKey | OPCXELSCUZSHQF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |