C12H13ClN2 — CID 62741656
2-(2-chloroanilino)cyclopentane-1-carbonitrile (PubChem CID 62741656) has the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. Its IUPAC name is 2-(2-chloroanilino)cyclopentane-1-carbonitrile.
| Compound Name | 2-(2-chloroanilino)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 62741656 |
| Molecular Formula | C12H13ClN2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-(2-chloroanilino)cyclopentane-1-carbonitrile |
| SMILES | N#CC1CCCC1Nc1ccccc1Cl |
| InChI | InChI=1S/C12H13ClN2/c13-10-5-1-2-6-12(10)15-11-7-3-4-9(11)8-14/h1-2,5-6,9,11,15H,3-4,7H2 |
| InChIKey | GMQPFLBUFUVJQZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |