C12H11Cl3N2 — CID 62743926
2-(2,4,6-trichloroanilino)cyclopentane-1-carbonitrile (PubChem CID 62743926) has the molecular formula C12H11Cl3N2 and a molecular weight of 289.59 g/mol. Its IUPAC name is 2-(2,4,6-trichloroanilino)cyclopentane-1-carbonitrile.
| Compound Name | 2-(2,4,6-trichloroanilino)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 62743926 |
| Molecular Formula | C12H11Cl3N2 |
| Molecular Weight | 289.59 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 2-(2,4,6-trichloroanilino)cyclopentane-1-carbonitrile |
| SMILES | N#CC1CCCC1Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl3N2/c13-8-4-9(14)12(10(15)5-8)17-11-3-1-2-7(11)6-16/h4-5,7,11,17H,1-3H2 |
| InChIKey | LHTCMINDADXYBE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |