C13H13BrF5N — CID 102853225
5-bromo-2,4-difluoro-N-[2-(trifluoromethyl)cyclohexyl]aniline (PubChem CID 102853225) has the molecular formula C13H13BrF5N and a molecular weight of 358.15 g/mol. Its IUPAC name is 5-bromo-2,4-difluoro-N-[2-(trifluoromethyl)cyclohexyl]aniline.
| Compound Name | 5-bromo-2,4-difluoro-N-[2-(trifluoromethyl)cyclohexyl]aniline |
|---|---|
| PubChem CID | 102853225 |
| Molecular Formula | C13H13BrF5N |
| Molecular Weight | 358.15 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 5-bromo-2,4-difluoro-N-[2-(trifluoromethyl)cyclohexyl]aniline |
| SMILES | Fc1cc(F)c(NC2CCCCC2C(F)(F)F)cc1Br |
| InChI | InChI=1S/C13H13BrF5N/c14-8-5-12(10(16)6-9(8)15)20-11-4-2-1-3-7(11)13(17,18)19/h5-7,11,20H,1-4H2 |
| InChIKey | LOGGPXJUJGYWGU-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.15 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|