C16H18BrF2N — CID 102852658
N-(5-bromo-2,4-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 102852658) has the molecular formula C16H18BrF2N and a molecular weight of 342.23 g/mol. Its IUPAC name is N-(5-bromo-2,4-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | N-(5-bromo-2,4-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 102852658 |
| Molecular Formula | C16H18BrF2N |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | N-(5-bromo-2,4-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | Fc1cc(F)c(NC2CC3CC2C2CCCC32)cc1Br |
| InChI | InChI=1S/C16H18BrF2N/c17-12-6-16(14(19)7-13(12)18)20-15-5-8-4-11(15)10-3-1-2-9(8)10/h6-11,15,20H,1-5H2 |
| InChIKey | POCDCMCQKIZDKW-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|