C17H22FN — CID 43503196
N-(4-fluoro-2-methylphenyl)tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 43503196) has the molecular formula C17H22FN and a molecular weight of 259.37 g/mol. Its IUPAC name is N-(4-fluoro-2-methylphenyl)tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | N-(4-fluoro-2-methylphenyl)tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 43503196 |
| Molecular Formula | C17H22FN |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-(4-fluoro-2-methylphenyl)tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | Cc1cc(F)ccc1NC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C17H22FN/c1-10-7-12(18)5-6-16(10)19-17-9-11-8-15(17)14-4-2-3-13(11)14/h5-7,11,13-15,17,19H,2-4,8-9H2,1H3 |
| InChIKey | FVAAZOBSEXWWIB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |