C16H22N2 — CID 107584885
5-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)pyridin-3-amine (PubChem CID 107584885) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 5-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)pyridin-3-amine.
| Compound Name | 5-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)pyridin-3-amine |
|---|---|
| PubChem CID | 107584885 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 5-methyl-N-(8-tricyclo[5.2.1.02,6]decanyl)pyridin-3-amine |
| SMILES | Cc1cncc(NC2CC3CC2C2CCCC32)c1 |
| InChI | InChI=1S/C16H22N2/c1-10-5-12(9-17-8-10)18-16-7-11-6-15(16)14-4-2-3-13(11)14/h5,8-9,11,13-16,18H,2-4,6-7H2,1H3 |
| InChIKey | HIIWESNDOUYKBO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |