C13H19N3 — CID 107584928
N-(5-methyl-3-pyridinyl)-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 107584928) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is N-(5-methyl-3-pyridinyl)-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | N-(5-methyl-3-pyridinyl)-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 107584928 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N-(5-methyl-3-pyridinyl)-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | Cc1cncc(NC2CN3CCC2CC3)c1 |
| InChI | InChI=1S/C13H19N3/c1-10-6-12(8-14-7-10)15-13-9-16-4-2-11(13)3-5-16/h6-8,11,13,15H,2-5,9H2,1H3 |
| InChIKey | XHTZIECFXRLGJM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |