C12H17ClN4 — CID 170444097
(3R)-N-(6-chloro-5-methylpyridazin-3-yl)-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 170444097) has the molecular formula C12H17ClN4 and a molecular weight of 252.75 g/mol. Its IUPAC name is (3R)-N-(6-chloro-5-methylpyridazin-3-yl)-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | (3R)-N-(6-chloro-5-methylpyridazin-3-yl)-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 170444097 |
| Molecular Formula | C12H17ClN4 |
| Molecular Weight | 252.75 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (3R)-N-(6-chloro-5-methylpyridazin-3-yl)-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | Cc1cc(N[C@H]2CN3CCC2CC3)nnc1Cl |
| InChI | InChI=1S/C12H17ClN4/c1-8-6-11(15-16-12(8)13)14-10-7-17-4-2-9(10)3-5-17/h6,9-10H,2-5,7H2,1H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | MAWMTKFCJBPJLU-JTQLQIEISA-N |
| XLogP | 1.94 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.75 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |