C16H18F3N — CID 43503157
N-(2,3,4-trifluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 43503157) has the molecular formula C16H18F3N and a molecular weight of 281.32 g/mol. Its IUPAC name is N-(2,3,4-trifluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | N-(2,3,4-trifluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 43503157 |
| Molecular Formula | C16H18F3N |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-(2,3,4-trifluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | Fc1ccc(NC2CC3CC2C2CCCC32)c(F)c1F |
| InChI | InChI=1S/C16H18F3N/c17-12-4-5-13(16(19)15(12)18)20-14-7-8-6-11(14)10-3-1-2-9(8)10/h4-5,8-11,14,20H,1-3,6-7H2 |
| InChIKey | BRYVQJLFAYFNIM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|