C18H22FNO — CID 124794619
2-(2-fluorophenyl)-N-[(1R,2S,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide (PubChem CID 124794619) has the molecular formula C18H22FNO and a molecular weight of 287.38 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-N-[(1R,2S,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide.
| Compound Name | 2-(2-fluorophenyl)-N-[(1R,2S,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide |
|---|---|
| PubChem CID | 124794619 |
| Molecular Formula | C18H22FNO |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-(2-fluorophenyl)-N-[(1R,2S,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide |
| SMILES | O=C(Cc1ccccc1F)N[C@@H]1C[C@H]2C[C@H]1[C@H]1CCC[C@@H]21 |
| InChI | InChI=1S/C18H22FNO/c19-16-7-2-1-4-11(16)10-18(21)20-17-9-12-8-15(17)14-6-3-5-13(12)14/h1-2,4,7,12-15,17H,3,5-6,8-10H2,(H,20,21)/t12-,13+,14+,15+,17-/m1/s1 |
| InChIKey | SIIBRWNMNXBZEI-JLHDYFKBSA-N |
| XLogP | 3.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |