C20H27NO3 — CID 124786370
2-(2-phenoxyethoxy)-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide (PubChem CID 124786370) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-(2-phenoxyethoxy)-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide.
| Compound Name | 2-(2-phenoxyethoxy)-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide |
|---|---|
| PubChem CID | 124786370 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 2-(2-phenoxyethoxy)-N-[(1R,2R,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide |
| SMILES | O=C(COCCOc1ccccc1)N[C@@H]1C[C@H]2C[C@H]1[C@@H]1CCC[C@H]21 |
| InChI | InChI=1S/C20H27NO3/c22-20(13-23-9-10-24-15-5-2-1-3-6-15)21-19-12-14-11-18(19)17-8-4-7-16(14)17/h1-3,5-6,14,16-19H,4,7-13H2,(H,21,22)/t14-,16-,17-,18+,19-/m1/s1 |
| InChIKey | VHZCYMZOLXHQPC-RXABAKJHSA-N |
| XLogP | 3.02 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|