C24H30N2O3 — CID 124834964
2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]-N-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide (PubChem CID 124834964) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]-N-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide.
| Compound Name | 2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]-N-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide |
|---|---|
| PubChem CID | 124834964 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]-N-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide |
| SMILES | Cc1noc(C)c1COc1ccc(CC(=O)N[C@@H]2C[C@H]3C[C@H]2[C@H]2CCC[C@H]32)cc1 |
| InChI | InChI=1S/C24H30N2O3/c1-14-22(15(2)29-26-14)13-28-18-8-6-16(7-9-18)10-24(27)25-23-12-17-11-21(23)20-5-3-4-19(17)20/h6-9,17,19-21,23H,3-5,10-13H2,1-2H3,(H,25,27)/t17-,19-,20+,21+,23-/m1/s1 |
| InChIKey | DEQVGGOTTVQKLE-ZNCFPDGUSA-N |
| XLogP | 4.35 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |