C23H34ClN3O3 — CID 119261110
N-[2-(cycloheptylamino)ethyl]-2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]acetamide;hydrochloride (PubChem CID 119261110) has the molecular formula C23H34ClN3O3 and a molecular weight of 436.00 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]acetamide;hydrochloride.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119261110 |
| Molecular Formula | C23H34ClN3O3 |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]acetamide;hydrochloride |
| SMILES | Cc1noc(C)c1COc1ccc(CC(=O)NCCNC2CCCCCC2)cc1.Cl |
| InChI | InChI=1S/C23H33N3O3.ClH/c1-17-22(18(2)29-26-17)16-28-21-11-9-19(10-12-21)15-23(27)25-14-13-24-20-7-5-3-4-6-8-20;/h9-12,20,24H,3-8,13-16H2,1-2H3,(H,25,27);1H |
| InChIKey | CNXODGANHCYMJE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|