C24H32N2O5 — CID 11901576
[2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]acetate (PubChem CID 11901576) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is [2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]acetate.
| Compound Name | [2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 11901576 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | [2-[[(1S,2S,3R)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]acetate |
| SMILES | Cc1noc(C)c1COc1ccc(CC(=O)OCC(=O)N[C@H]2CCC[C@@H](C)[C@@H]2C)cc1 |
| InChI | InChI=1S/C24H32N2O5/c1-15-6-5-7-22(16(15)2)25-23(27)14-30-24(28)12-19-8-10-20(11-9-19)29-13-21-17(3)26-31-18(21)4/h8-11,15-16,22H,5-7,12-14H2,1-4H3,(H,25,27)/t15-,16+,22+/m1/s1 |
| InChIKey | UTKCNIDUWLVUOM-VVBPWWLESA-N |
| XLogP | 3.90 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |