C19H24N2O3 — CID 78851563
4-(2-amino-2-oxoethoxy)-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide (PubChem CID 78851563) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide |
|---|---|
| PubChem CID | 78851563 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide |
| SMILES | NC(=O)COc1ccc(C(=O)NC2CC3CC2C2CCCC32)cc1 |
| InChI | InChI=1S/C19H24N2O3/c20-18(22)10-24-13-6-4-11(5-7-13)19(23)21-17-9-12-8-16(17)15-3-1-2-14(12)15/h4-7,12,14-17H,1-3,8-10H2,(H2,20,22)(H,21,23) |
| InChIKey | LAGLDRFCQIHGPV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |