C20H29NO2 — CID 15523776
(1S,2R,6R,7S,8R)-N-[[3-(2-methoxyethoxy)phenyl]methyl]tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 15523776) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is (1S,2R,6R,7S,8R)-N-[[3-(2-methoxyethoxy)phenyl]methyl]tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | (1S,2R,6R,7S,8R)-N-[[3-(2-methoxyethoxy)phenyl]methyl]tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 15523776 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | (1S,2R,6R,7S,8R)-N-[[3-(2-methoxyethoxy)phenyl]methyl]tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | COCCOc1cccc(CN[C@@H]2C[C@@H]3C[C@H]2[C@@H]2CCC[C@H]32)c1 |
| InChI | InChI=1S/C20H29NO2/c1-22-8-9-23-16-5-2-4-14(10-16)13-21-20-12-15-11-19(20)18-7-3-6-17(15)18/h2,4-5,10,15,17-21H,3,6-9,11-13H2,1H3/t15-,17+,18+,19-,20+/m0/s1 |
| InChIKey | FWMMIMNUOFZWCB-FAJAVTLNSA-N |
| XLogP | 3.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|