C19H27N3O3 — CID 129005833
(2R,3S)-N-[[3-(2-methoxyethoxy)phenyl]methyl]-2-(1-methylpyrazol-4-yl)oxan-3-amine (PubChem CID 129005833) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is (2R,3S)-N-[[3-(2-methoxyethoxy)phenyl]methyl]-2-(1-methylpyrazol-4-yl)oxan-3-amine.
| Compound Name | (2R,3S)-N-[[3-(2-methoxyethoxy)phenyl]methyl]-2-(1-methylpyrazol-4-yl)oxan-3-amine |
|---|---|
| PubChem CID | 129005833 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (2R,3S)-N-[[3-(2-methoxyethoxy)phenyl]methyl]-2-(1-methylpyrazol-4-yl)oxan-3-amine |
| SMILES | COCCOc1cccc(CN[C@H]2CCCO[C@@H]2c2cnn(C)c2)c1 |
| InChI | InChI=1S/C19H27N3O3/c1-22-14-16(13-21-22)19-18(7-4-8-25-19)20-12-15-5-3-6-17(11-15)24-10-9-23-2/h3,5-6,11,13-14,18-20H,4,7-10,12H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | ZYDJVQNIQYXWEG-RBUKOAKNSA-N |
| XLogP | 2.46 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|