C20H28N4O2 — CID 128968973
(2R,3S)-2-(1-methylpyrazol-4-yl)-N-[(4-morpholin-4-ylphenyl)methyl]oxan-3-amine (PubChem CID 128968973) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is (2R,3S)-2-(1-methylpyrazol-4-yl)-N-[(4-morpholin-4-ylphenyl)methyl]oxan-3-amine.
| Compound Name | (2R,3S)-2-(1-methylpyrazol-4-yl)-N-[(4-morpholin-4-ylphenyl)methyl]oxan-3-amine |
|---|---|
| PubChem CID | 128968973 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (2R,3S)-2-(1-methylpyrazol-4-yl)-N-[(4-morpholin-4-ylphenyl)methyl]oxan-3-amine |
| SMILES | Cn1cc([C@H]2OCCC[C@@H]2NCc2ccc(N3CCOCC3)cc2)cn1 |
| InChI | InChI=1S/C20H28N4O2/c1-23-15-17(14-22-23)20-19(3-2-10-26-20)21-13-16-4-6-18(7-5-16)24-8-11-25-12-9-24/h4-7,14-15,19-21H,2-3,8-13H2,1H3/t19-,20+/m0/s1 |
| InChIKey | CNBLZYYMUVPCTP-VQTJNVASSA-N |
| XLogP | 2.27 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|