C19H26N4O3 — CID 129002540
(5R,6S)-5-[[3-(2-methoxyethoxy)phenyl]methylamino]-6-(1-methylpyrazol-4-yl)piperidin-2-one (PubChem CID 129002540) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is (5R,6S)-5-[[3-(2-methoxyethoxy)phenyl]methylamino]-6-(1-methylpyrazol-4-yl)piperidin-2-one.
| Compound Name | (5R,6S)-5-[[3-(2-methoxyethoxy)phenyl]methylamino]-6-(1-methylpyrazol-4-yl)piperidin-2-one |
|---|---|
| PubChem CID | 129002540 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (5R,6S)-5-[[3-(2-methoxyethoxy)phenyl]methylamino]-6-(1-methylpyrazol-4-yl)piperidin-2-one |
| SMILES | COCCOc1cccc(CN[C@@H]2CCC(=O)NC2c2cnn(C)c2)c1 |
| InChI | InChI=1S/C19H26N4O3/c1-23-13-15(12-21-23)19-17(6-7-18(24)22-19)20-11-14-4-3-5-16(10-14)26-9-8-25-2/h3-5,10,12-13,17,19-20H,6-9,11H2,1-2H3,(H,22,24)/t17-,19?/m1/s1 |
| InChIKey | PLDNJYTXBMVBBH-DUSLRRAJSA-N |
| XLogP | 1.55 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|