C17H22ClN — CID 15523767
(1S,2R,6R,7S,8R)-N-[(3-chlorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 15523767) has the molecular formula C17H22ClN and a molecular weight of 275.82 g/mol. Its IUPAC name is (1S,2R,6R,7S,8R)-N-[(3-chlorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | (1S,2R,6R,7S,8R)-N-[(3-chlorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 15523767 |
| Molecular Formula | C17H22ClN |
| Molecular Weight | 275.82 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | (1S,2R,6R,7S,8R)-N-[(3-chlorophenyl)methyl]tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | Clc1cccc(CN[C@@H]2C[C@@H]3C[C@H]2[C@@H]2CCC[C@H]32)c1 |
| InChI | InChI=1S/C17H22ClN/c18-13-4-1-3-11(7-13)10-19-17-9-12-8-16(17)15-6-2-5-14(12)15/h1,3-4,7,12,14-17,19H,2,5-6,8-10H2/t12-,14+,15+,16-,17+/m0/s1 |
| InChIKey | ZLQQYCJALXJAQS-BYHHXJKWSA-N |
| XLogP | 4.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.82 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |