C15H21NO — CID 16775468
N-(furan-2-ylmethyl)tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 16775468) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | N-(furan-2-ylmethyl)tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 16775468 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | N-(furan-2-ylmethyl)tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | c1coc(CNC2CC3CC2C2CCCC32)c1 |
| InChI | InChI=1S/C15H21NO/c1-4-12-10-7-14(13(12)5-1)15(8-10)16-9-11-3-2-6-17-11/h2-3,6,10,12-16H,1,4-5,7-9H2 |
| InChIKey | XYUYXZDDRGYMAR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |