C11H18N2O — CID 124676095
cis-(1S,2R)-2-N-(furan-2-ylmethyl)cyclohexane-1,2-diamine (PubChem CID 124676095) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is cis-(1S,2R)-2-N-(furan-2-ylmethyl)cyclohexane-1,2-diamine.
| Compound Name | cis-(1S,2R)-2-N-(furan-2-ylmethyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 124676095 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | cis-(1S,2R)-2-N-(furan-2-ylmethyl)cyclohexane-1,2-diamine |
| SMILES | N[C@H]1CCCC[C@H]1NCc1ccco1 |
| InChI | InChI=1S/C11H18N2O/c12-10-5-1-2-6-11(10)13-8-9-4-3-7-14-9/h3-4,7,10-11,13H,1-2,5-6,8,12H2/t10-,11+/m0/s1 |
| InChIKey | OJAKRWMKSPPCLX-WDEREUQCSA-N |
| XLogP | 1.64 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |