C12H19NO — CID 64908204
N-(furan-2-ylmethyl)-2,3-dimethylcyclopentan-1-amine (PubChem CID 64908204) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2,3-dimethylcyclopentan-1-amine.
| Compound Name | N-(furan-2-ylmethyl)-2,3-dimethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 64908204 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-(furan-2-ylmethyl)-2,3-dimethylcyclopentan-1-amine |
| SMILES | CC1CCC(NCc2ccco2)C1C |
| InChI | InChI=1S/C12H19NO/c1-9-5-6-12(10(9)2)13-8-11-4-3-7-14-11/h3-4,7,9-10,12-13H,5-6,8H2,1-2H3 |
| InChIKey | IQUYXXQCLFZBSW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |