C17H22FNO — CID 115951364
2-fluoro-6-[(8-tricyclo[5.2.1.02,6]decanylamino)methyl]phenol (PubChem CID 115951364) has the molecular formula C17H22FNO and a molecular weight of 275.37 g/mol. Its IUPAC name is 2-fluoro-6-[(8-tricyclo[5.2.1.02,6]decanylamino)methyl]phenol.
| Compound Name | 2-fluoro-6-[(8-tricyclo[5.2.1.02,6]decanylamino)methyl]phenol |
|---|---|
| PubChem CID | 115951364 |
| Molecular Formula | C17H22FNO |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 2-fluoro-6-[(8-tricyclo[5.2.1.02,6]decanylamino)methyl]phenol |
| SMILES | Oc1c(F)cccc1CNC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C17H22FNO/c18-15-6-1-3-10(17(15)20)9-19-16-8-11-7-14(16)13-5-2-4-12(11)13/h1,3,6,11-14,16,19-20H,2,4-5,7-9H2 |
| InChIKey | LXOOIFSJDPLPPZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|