C16H22N2 — CID 20726962
N-(pyridin-2-ylmethyl)tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 20726962) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | N-(pyridin-2-ylmethyl)tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 20726962 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | N-(pyridin-2-ylmethyl)tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | c1ccc(CNC2CC3CC2C2CCCC32)nc1 |
| InChI | InChI=1S/C16H22N2/c1-2-7-17-12(4-1)10-18-16-9-11-8-15(16)14-6-3-5-13(11)14/h1-2,4,7,11,13-16,18H,3,5-6,8-10H2 |
| InChIKey | SAQLNQGEBXMUJS-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |