C16H25N3 — CID 79545513
2-piperidin-2-yl-N-(pyridin-2-ylmethyl)cyclopentan-1-amine (PubChem CID 79545513) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 2-piperidin-2-yl-N-(pyridin-2-ylmethyl)cyclopentan-1-amine.
| Compound Name | 2-piperidin-2-yl-N-(pyridin-2-ylmethyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 79545513 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 2-piperidin-2-yl-N-(pyridin-2-ylmethyl)cyclopentan-1-amine |
| SMILES | c1ccc(CNC2CCCC2C2CCCCN2)nc1 |
| InChI | InChI=1S/C16H25N3/c1-3-10-17-13(6-1)12-19-16-9-5-7-14(16)15-8-2-4-11-18-15/h1,3,6,10,14-16,18-19H,2,4-5,7-9,11-12H2 |
| InChIKey | POZJEZOBHABRFM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |