C17H25ClN2 — CID 79545200
N-[(2-chlorophenyl)methyl]-2-piperidin-2-ylcyclopentan-1-amine (PubChem CID 79545200) has the molecular formula C17H25ClN2 and a molecular weight of 292.85 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-2-piperidin-2-ylcyclopentan-1-amine.
| Compound Name | N-[(2-chlorophenyl)methyl]-2-piperidin-2-ylcyclopentan-1-amine |
|---|---|
| PubChem CID | 79545200 |
| Molecular Formula | C17H25ClN2 |
| Molecular Weight | 292.85 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-2-piperidin-2-ylcyclopentan-1-amine |
| SMILES | Clc1ccccc1CNC1CCCC1C1CCCCN1 |
| InChI | InChI=1S/C17H25ClN2/c18-15-8-2-1-6-13(15)12-20-17-10-5-7-14(17)16-9-3-4-11-19-16/h1-2,6,8,14,16-17,19-20H,3-5,7,9-12H2 |
| InChIKey | AAOIDJQNCNARCJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.85 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |