C13H18N2 — CID 98119416
(1R,2R,4R)-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptan-2-amine (PubChem CID 98119416) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (1R,2R,4R)-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1R,2R,4R)-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 98119416 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (1R,2R,4R)-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptan-2-amine |
| SMILES | c1ccc(CN[C@@H]2C[C@@H]3CC[C@@H]2C3)nc1 |
| InChI | InChI=1S/C13H18N2/c1-2-6-14-12(3-1)9-15-13-8-10-4-5-11(13)7-10/h1-3,6,10-11,13,15H,4-5,7-9H2/t10-,11-,13-/m1/s1 |
| InChIKey | YEHWTDHVFHJIQE-NQBHXWOUSA-N |
| XLogP | 2.36 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |