C17H26FNO — CID 115951251
2-fluoro-6-[[(5-methyl-2-propan-2-ylcyclohexyl)amino]methyl]phenol (PubChem CID 115951251) has the molecular formula C17H26FNO and a molecular weight of 279.40 g/mol. Its IUPAC name is 2-fluoro-6-[[(5-methyl-2-propan-2-ylcyclohexyl)amino]methyl]phenol.
| Compound Name | 2-fluoro-6-[[(5-methyl-2-propan-2-ylcyclohexyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 115951251 |
| Molecular Formula | C17H26FNO |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 2-fluoro-6-[[(5-methyl-2-propan-2-ylcyclohexyl)amino]methyl]phenol |
| SMILES | CC1CCC(C(C)C)C(NCc2cccc(F)c2O)C1 |
| InChI | InChI=1S/C17H26FNO/c1-11(2)14-8-7-12(3)9-16(14)19-10-13-5-4-6-15(18)17(13)20/h4-6,11-12,14,16,19-20H,7-10H2,1-3H3 |
| InChIKey | OTSQJIKBFBGGCW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|