C19H25F2NO2 — CID 11946796
(1R,2R,6S,7R,8S)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 11946796) has the molecular formula C19H25F2NO2 and a molecular weight of 337.41 g/mol. Its IUPAC name is (1R,2R,6S,7R,8S)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | (1R,2R,6S,7R,8S)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 11946796 |
| Molecular Formula | C19H25F2NO2 |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (1R,2R,6S,7R,8S)-N-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | COc1cc(CN[C@H]2C[C@H]3C[C@@H]2[C@H]2CCC[C@H]32)ccc1OC(F)F |
| InChI | InChI=1S/C19H25F2NO2/c1-23-18-7-11(5-6-17(18)24-19(20)21)10-22-16-9-12-8-15(16)14-4-2-3-13(12)14/h5-7,12-16,19,22H,2-4,8-10H2,1H3/t12-,13-,14+,15-,16+/m1/s1 |
| InChIKey | SWRBZYJWFWQSBW-LJIZCISZSA-N |
| XLogP | 4.21 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |