C14H18F2N2O3 — CID 63378779
5-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]piperidin-2-one (PubChem CID 63378779) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.31 g/mol. Its IUPAC name is 5-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]piperidin-2-one.
| Compound Name | 5-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]piperidin-2-one |
|---|---|
| PubChem CID | 63378779 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 5-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]piperidin-2-one |
| SMILES | COc1ccc(CNC2CCC(=O)NC2)cc1OC(F)F |
| InChI | InChI=1S/C14H18F2N2O3/c1-20-11-4-2-9(6-12(11)21-14(15)16)7-17-10-3-5-13(19)18-8-10/h2,4,6,10,14,17H,3,5,7-8H2,1H3,(H,18,19) |
| InChIKey | YMXHMRCQISIRHI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |