C15H19F2NO3 — CID 80611753
N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-7-oxabicyclo[2.2.1]heptan-2-amine (PubChem CID 80611753) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-7-oxabicyclo[2.2.1]heptan-2-amine.
| Compound Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-7-oxabicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 80611753 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-7-oxabicyclo[2.2.1]heptan-2-amine |
| SMILES | COc1ccc(CNC2CC3CCC2O3)cc1OC(F)F |
| InChI | InChI=1S/C15H19F2NO3/c1-19-13-4-2-9(6-14(13)21-15(16)17)8-18-11-7-10-3-5-12(11)20-10/h2,4,6,10-12,15,18H,3,5,7-8H2,1H3 |
| InChIKey | XFOBXDNFLHAPOT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |