C14H19NO2 — CID 80601611
N-[(2-methoxyphenyl)methyl]-7-oxabicyclo[2.2.1]heptan-2-amine (PubChem CID 80601611) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-7-oxabicyclo[2.2.1]heptan-2-amine.
| Compound Name | N-[(2-methoxyphenyl)methyl]-7-oxabicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 80601611 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-7-oxabicyclo[2.2.1]heptan-2-amine |
| SMILES | COc1ccccc1CNC1CC2CCC1O2 |
| InChI | InChI=1S/C14H19NO2/c1-16-13-5-3-2-4-10(13)9-15-12-8-11-6-7-14(12)17-11/h2-5,11-12,14-15H,6-9H2,1H3 |
| InChIKey | UGXXMTWKVMYFDI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |