C18H22N2O4 — CID 124780220
2-(2-nitrophenoxy)-N-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide (PubChem CID 124780220) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-(2-nitrophenoxy)-N-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide.
| Compound Name | 2-(2-nitrophenoxy)-N-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide |
|---|---|
| PubChem CID | 124780220 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-(2-nitrophenoxy)-N-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]acetamide |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])N[C@@H]1C[C@H]2C[C@H]1[C@@H]1CCC[C@@H]21 |
| InChI | InChI=1S/C18H22N2O4/c21-18(10-24-17-7-2-1-6-16(17)20(22)23)19-15-9-11-8-14(15)13-5-3-4-12(11)13/h1-2,6-7,11-15H,3-5,8-10H2,(H,19,21)/t11-,12+,13-,14+,15-/m1/s1 |
| InChIKey | ZZUHCLYKPZDJLG-QKGCVVFFSA-N |
| XLogP | 2.91 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|