C20H23N — CID 43503137
N-naphthalen-1-yltricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 43503137) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is N-naphthalen-1-yltricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | N-naphthalen-1-yltricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 43503137 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-naphthalen-1-yltricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | c1ccc2c(NC3CC4CC3C3CCCC43)cccc2c1 |
| InChI | InChI=1S/C20H23N/c1-2-7-16-13(5-1)6-3-10-19(16)21-20-12-14-11-18(20)17-9-4-8-15(14)17/h1-3,5-7,10,14-15,17-18,20-21H,4,8-9,11-12H2 |
| InChIKey | NMDNANMSDLVGMJ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |