C13H14BrF4N — CID 104775706
3-bromo-4-fluoro-N-[2-(trifluoromethyl)cyclohexyl]aniline (PubChem CID 104775706) has the molecular formula C13H14BrF4N and a molecular weight of 340.16 g/mol. Its IUPAC name is 3-bromo-4-fluoro-N-[2-(trifluoromethyl)cyclohexyl]aniline.
| Compound Name | 3-bromo-4-fluoro-N-[2-(trifluoromethyl)cyclohexyl]aniline |
|---|---|
| PubChem CID | 104775706 |
| Molecular Formula | C13H14BrF4N |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 3-bromo-4-fluoro-N-[2-(trifluoromethyl)cyclohexyl]aniline |
| SMILES | Fc1ccc(NC2CCCCC2C(F)(F)F)cc1Br |
| InChI | InChI=1S/C13H14BrF4N/c14-10-7-8(5-6-11(10)15)19-12-4-2-1-3-9(12)13(16,17)18/h5-7,9,12,19H,1-4H2 |
| InChIKey | QZVKLIQBFPTGHT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |