C13H13Cl2F4N — CID 107572992
3,5-dichloro-4-fluoro-N-[2-(trifluoromethyl)cyclohexyl]aniline (PubChem CID 107572992) has the molecular formula C13H13Cl2F4N and a molecular weight of 330.15 g/mol. Its IUPAC name is 3,5-dichloro-4-fluoro-N-[2-(trifluoromethyl)cyclohexyl]aniline.
| Compound Name | 3,5-dichloro-4-fluoro-N-[2-(trifluoromethyl)cyclohexyl]aniline |
|---|---|
| PubChem CID | 107572992 |
| Molecular Formula | C13H13Cl2F4N |
| Molecular Weight | 330.15 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 3,5-dichloro-4-fluoro-N-[2-(trifluoromethyl)cyclohexyl]aniline |
| SMILES | Fc1c(Cl)cc(NC2CCCCC2C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H13Cl2F4N/c14-9-5-7(6-10(15)12(9)16)20-11-4-2-1-3-8(11)13(17,18)19/h5-6,8,11,20H,1-4H2 |
| InChIKey | LRDUBSJFUIXWIH-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.15 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|