C17H26BrN — CID 107571902
4-bromo-3,5-dimethyl-N-(2-propan-2-ylcyclohexyl)aniline (PubChem CID 107571902) has the molecular formula C17H26BrN and a molecular weight of 324.31 g/mol. Its IUPAC name is 4-bromo-3,5-dimethyl-N-(2-propan-2-ylcyclohexyl)aniline.
| Compound Name | 4-bromo-3,5-dimethyl-N-(2-propan-2-ylcyclohexyl)aniline |
|---|---|
| PubChem CID | 107571902 |
| Molecular Formula | C17H26BrN |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 4-bromo-3,5-dimethyl-N-(2-propan-2-ylcyclohexyl)aniline |
| SMILES | Cc1cc(NC2CCCCC2C(C)C)cc(C)c1Br |
| InChI | InChI=1S/C17H26BrN/c1-11(2)15-7-5-6-8-16(15)19-14-9-12(3)17(18)13(4)10-14/h9-11,15-16,19H,5-8H2,1-4H3 |
| InChIKey | GUXOFBQVVRKGNR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |