C15H20Cl2FN — CID 83078747
2,6-dichloro-4-fluoro-N-(2-propan-2-ylcyclohexyl)aniline (PubChem CID 83078747) has the molecular formula C15H20Cl2FN and a molecular weight of 304.24 g/mol. Its IUPAC name is 2,6-dichloro-4-fluoro-N-(2-propan-2-ylcyclohexyl)aniline.
| Compound Name | 2,6-dichloro-4-fluoro-N-(2-propan-2-ylcyclohexyl)aniline |
|---|---|
| PubChem CID | 83078747 |
| Molecular Formula | C15H20Cl2FN |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2,6-dichloro-4-fluoro-N-(2-propan-2-ylcyclohexyl)aniline |
| SMILES | CC(C)C1CCCCC1Nc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C15H20Cl2FN/c1-9(2)11-5-3-4-6-14(11)19-15-12(16)7-10(18)8-13(15)17/h7-9,11,14,19H,3-6H2,1-2H3 |
| InChIKey | IARNUQINVQDCAQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |