C11H12ClF2NO — CID 102733945
trans-(1S,2S)-2-(2-chloro-4,6-difluoroanilino)cyclopentan-1-ol (PubChem CID 102733945) has the molecular formula C11H12ClF2NO and a molecular weight of 247.67 g/mol. Its IUPAC name is trans-(1S,2S)-2-(2-chloro-4,6-difluoroanilino)cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-(2-chloro-4,6-difluoroanilino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102733945 |
| Molecular Formula | C11H12ClF2NO |
| Molecular Weight | 247.67 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | trans-(1S,2S)-2-(2-chloro-4,6-difluoroanilino)cyclopentan-1-ol |
| SMILES | O[C@H]1CCC[C@@H]1Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C11H12ClF2NO/c12-7-4-6(13)5-8(14)11(7)15-9-2-1-3-10(9)16/h4-5,9-10,15-16H,1-3H2/t9-,10-/m0/s1 |
| InChIKey | NRJUUCDFTBJXBX-UWVGGRQHSA-N |
| XLogP | 2.94 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.67 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |